Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
16039-53-5
Futurechemical
16039-53-5
| Zinc lactate Basic information | |
| Product Name: | Zinc lactate |
| CAS: | 16039-53-5 |
| MF: | C6H8O6Zn |
| MW: | 241.5 |
| EINECS: | 240-178-9 |
| Mol File: | 16039-53-5.mol |
| Zinc lactate Chemical Properties | |
| Melting point | >256°C (subl.) |
| density | 1.65[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| pka | 8.51[at 20 ℃] |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 48.2g/L at 20℃ |
| InChI | InChI=1S/2C3H5O3.Zn/c2*1-2(4)3(5)6;/h2*2H,1H3,(H,5,6);/q2*-1;+4/p-2 |
| InChIKey | VRTAAVXOETYMFZ-UHFFFAOYSA-L |
| SMILES | CC1C([O-][Zn+2]2([O-]C(=O)C(C)O2)O1)=O |
| LogP | 0 at 20℃ |
| CAS DataBase Reference | 16039-53-5(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc, bis[2-(hydroxy-.kappa.O)propanoato-.kappa.O]-, (T-4)- (16039-53-5) |
| ITEM | STANDARD | RESULTS |
| Characters | white crystals or powder | White crystals or powders |
| Identification | It responds to the tests for Zinc | Conform to the. test |
| Solubility | Slightly soluble in water. | Conform to the test |
| Assay (Anhydrous basis) % | ≥98.0 | 99.45 |
| Loss on drying % | ≤18.5 | 12.75 |
| PH (1%) | 5.0-7.0 | 5.61 |
| Heavy Metals | ≤10ppm | Complies |
| Lead (Pb) | ≤3ppm | Complies |
| Arsenic (As) | ≤3ppm | Complies |
| Cadmium(Cd) | ≤1ppm | Complies |
| Mercury (Hg) | ≤0.1ppm | Complies |
| Total viable count | NMT 1000 CFU/g | <1000 CFU/g |
| Yeast and Mould | NMT 100 CFU/g | <100 CFU/g |
| E. Coli | Negative/ g | Not detected |
| Salmonella | Negative / 25 g | Not detected |
| Melamine | Not detected | Not detected |
| Conclusion | Meets the standard | |


| Zinc lactate Basic information | |
| Product Name: | Zinc lactate |
| CAS: | 16039-53-5 |
| MF: | C6H8O6Zn |
| MW: | 241.5 |
| EINECS: | 240-178-9 |
| Mol File: | 16039-53-5.mol |
| Zinc lactate Chemical Properties | |
| Melting point | >256°C (subl.) |
| density | 1.65[at 20℃] |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | 2-8°C |
| solubility | Water (Slightly) |
| pka | 8.51[at 20 ℃] |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 48.2g/L at 20℃ |
| InChI | InChI=1S/2C3H5O3.Zn/c2*1-2(4)3(5)6;/h2*2H,1H3,(H,5,6);/q2*-1;+4/p-2 |
| InChIKey | VRTAAVXOETYMFZ-UHFFFAOYSA-L |
| SMILES | CC1C([O-][Zn+2]2([O-]C(=O)C(C)O2)O1)=O |
| LogP | 0 at 20℃ |
| CAS DataBase Reference | 16039-53-5(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc, bis[2-(hydroxy-.kappa.O)propanoato-.kappa.O]-, (T-4)- (16039-53-5) |
| ITEM | STANDARD | RESULTS |
| Characters | white crystals or powder | White crystals or powders |
| Identification | It responds to the tests for Zinc | Conform to the. test |
| Solubility | Slightly soluble in water. | Conform to the test |
| Assay (Anhydrous basis) % | ≥98.0 | 99.45 |
| Loss on drying % | ≤18.5 | 12.75 |
| PH (1%) | 5.0-7.0 | 5.61 |
| Heavy Metals | ≤10ppm | Complies |
| Lead (Pb) | ≤3ppm | Complies |
| Arsenic (As) | ≤3ppm | Complies |
| Cadmium(Cd) | ≤1ppm | Complies |
| Mercury (Hg) | ≤0.1ppm | Complies |
| Total viable count | NMT 1000 CFU/g | <1000 CFU/g |
| Yeast and Mould | NMT 100 CFU/g | <100 CFU/g |
| E. Coli | Negative/ g | Not detected |
| Salmonella | Negative / 25 g | Not detected |
| Melamine | Not detected | Not detected |
| Conclusion | Meets the standard | |


