| Availability: | |
|---|---|
| Quantity: | |
503-66-2
Futurechemical
503-66-2
| 3-Hydroxypropionic acid Basic information | |
| Product Name: | 3-Hydroxypropionic acid |
| CAS: | 503-66-2 |
| MF: | C3H6O3 |
| MW: | 90.08 |
| EINECS: | 207-974-8 |
| Mol File: | 503-66-2.mol |
| 3-Hydroxypropionic acid Chemical Properties | |
| Melting point | 16.8°C (estimate) |
| Boiling point | 212°C (rough estimate) |
| density | 1.066 g/mL at 25 °C |
| refractive index | 1.4489 |
| storage temp. | 2-8°C |
| solubility | Ethanol, Methanol, Water |
| pka | 4.51(at 25℃) |
| form | Colourless Solution |
| color | Colorless to Almost colorless |
| Water Solubility | 270.1g/L(25 ºC) |
| InChI | InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6) |
| InChIKey | ALRHLSYJTWAHJZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCO |
| CAS DataBase Reference | 503-66-2(CAS DataBase Reference) |


| 3-Hydroxypropionic acid Basic information | |
| Product Name: | 3-Hydroxypropionic acid |
| CAS: | 503-66-2 |
| MF: | C3H6O3 |
| MW: | 90.08 |
| EINECS: | 207-974-8 |
| Mol File: | 503-66-2.mol |
| 3-Hydroxypropionic acid Chemical Properties | |
| Melting point | 16.8°C (estimate) |
| Boiling point | 212°C (rough estimate) |
| density | 1.066 g/mL at 25 °C |
| refractive index | 1.4489 |
| storage temp. | 2-8°C |
| solubility | Ethanol, Methanol, Water |
| pka | 4.51(at 25℃) |
| form | Colourless Solution |
| color | Colorless to Almost colorless |
| Water Solubility | 270.1g/L(25 ºC) |
| InChI | InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6) |
| InChIKey | ALRHLSYJTWAHJZ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCO |
| CAS DataBase Reference | 503-66-2(CAS DataBase Reference) |

