Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
61788-44-1
futurechemical
61788-44-1
| Styrenated phenol Basic information | |
| Product Name: | Styrenated phenol |
| CAS: | 61788-44-1 |
| MF: | C30H30O |
| MW: | 406.56 |
| EINECS: | 262-975-0 |
| Mol File: | 61788-44-1.mol |
| Styrenated phenol Chemical Properties | |
| Boiling point | >250℃ |
| density | 1.08g/cm3 |
| vapor pressure | 0.1Pa at 20℃ |
| refractive index | 1.5785~1.6020 |
| Fp | 182℃ |
| storage temp. | Storage temp. 2-8°C |
| solubility | 1000g/L in organic solvents at 20 ℃ |
| pka | 0[at 20 ℃] |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 1.95mg/L at 22℃ |
| InChI | InChI=1S/C30H30O/c1-21(24-13-7-4-8-14-24)27-19-28(22(2)25-15-9-5-10-16-25)30(31)29(20-27)23(3)26-17-11-6-12-18-26/h4-23,31H,1-3H3 |
| InChIKey | BYLSIPUARIZAHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(C2C=CC=CC=2)C)C(O)=C1C(C1C=CC=CC=1)C)C(C1C=CC=CC=1)C |
| LogP | 3.03 at 23.6℃ |
| EPA Substance Registry System | Styrenated phenol (61788-44-1) |


| Styrenated phenol Basic information | |
| Product Name: | Styrenated phenol |
| CAS: | 61788-44-1 |
| MF: | C30H30O |
| MW: | 406.56 |
| EINECS: | 262-975-0 |
| Mol File: | 61788-44-1.mol |
| Styrenated phenol Chemical Properties | |
| Boiling point | >250℃ |
| density | 1.08g/cm3 |
| vapor pressure | 0.1Pa at 20℃ |
| refractive index | 1.5785~1.6020 |
| Fp | 182℃ |
| storage temp. | Storage temp. 2-8°C |
| solubility | 1000g/L in organic solvents at 20 ℃ |
| pka | 0[at 20 ℃] |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | 1.95mg/L at 22℃ |
| InChI | InChI=1S/C30H30O/c1-21(24-13-7-4-8-14-24)27-19-28(22(2)25-15-9-5-10-16-25)30(31)29(20-27)23(3)26-17-11-6-12-18-26/h4-23,31H,1-3H3 |
| InChIKey | BYLSIPUARIZAHZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(C2C=CC=CC=2)C)C(O)=C1C(C1C=CC=CC=1)C)C(C1C=CC=CC=1)C |
| LogP | 3.03 at 23.6℃ |
| EPA Substance Registry System | Styrenated phenol (61788-44-1) |


