English 
Tel:
+86-156-2878-2329
E-Mail：sales001@bosschemical.com
E-Mail：sales001@bosschemical.com
No. 55, Gongye South Road, Jinan Area, China (Shandong) Pilot Free Trade Zone.
 |
| Quantity: | |
|---|---|
39450-01-6
Futurechemical
39450-01-6
| Sodium xylenesulfonate Basic information | |
| Product Name: | Sodium xylenesulfonate |
| CAS: | 1300-72-7 |
| MF: | C8H9NaO3S |
| MW: | 208.21 |
| EINECS: | 215-090-9 |
| Mol File: | 1300-72-7.mol |
| Sodium xylenesulfonate Chemical Properties | |
| Melting point | 27°C |
| Boiling point | 157°C |
| density | 1.17 g/mL at 25 °C |
| refractive index | n20/D 1.405 |
| solubility | Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | >=10 g/100 mL at 20 ºC |
| Stability: | Stable. Combustible. Incompatible with acids, oxidizing agents. Moisture-sensitive. |
| InChI | InChI=1S/C8H10O3S.Na/c1-6-3-4-8(5-7(6)2)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | S([O-])(=O)(=O)C1C=CC(C)=C(C)C=1.[Na+] |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 1300-72-7(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium xylenesulfonate (1300-72-7) |
Test Items | Specifications | Test Results |
Appearance | White crystals | conform |
Active substance content, % | ≥90.0 | 91.6 |
Water content, % | ≤6.0 | 5.6 |
Inorganic salt, % | ≤4.0 | 2.8 |
PH | 7-9 |
7.8 |
| Sodium xylenesulfonate Basic information | |
| Product Name: | Sodium xylenesulfonate |
| CAS: | 1300-72-7 |
| MF: | C8H9NaO3S |
| MW: | 208.21 |
| EINECS: | 215-090-9 |
| Mol File: | 1300-72-7.mol |
| Sodium xylenesulfonate Chemical Properties | |
| Melting point | 27°C |
| Boiling point | 157°C |
| density | 1.17 g/mL at 25 °C |
| refractive index | n20/D 1.405 |
| solubility | Methanol (Slightly, Heated), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | >=10 g/100 mL at 20 ºC |
| Stability: | Stable. Combustible. Incompatible with acids, oxidizing agents. Moisture-sensitive. |
| InChI | InChI=1S/C8H10O3S.Na/c1-6-3-4-8(5-7(6)2)12(9,10)11;/h3-5H,1-2H3,(H,9,10,11);/q;+1/p-1 |
| InChIKey | QUCDWLYKDRVKMI-UHFFFAOYSA-M |
| SMILES | S([O-])(=O)(=O)C1C=CC(C)=C(C)C=1.[Na+] |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 1300-72-7(CAS DataBase Reference) |
| EPA Substance Registry System | Sodium xylenesulfonate (1300-72-7) |
Test Items | Specifications | Test Results |
Appearance | White crystals | conform |
Active substance content, % | ≥90.0 | 91.6 |
Water content, % | ≤6.0 | 5.6 |
Inorganic salt, % | ≤4.0 | 2.8 |
PH | 7-9 |
7.8 |
