Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
3081-61-6
Future Chemical
3081-61-6
| L-Theanine Basic information | |
| Product Name: | L-Theanine |
| CAS: | 3081-61-6 |
| MF: | C7H14N2O3 |
| MW: | 174.2 |
| EINECS: | 221-379-0 |
| Mol File: | 3081-61-6.mol |
| L-Theanine Chemical Properties | |
| Melting point | 207°C |
| Boiling point | 430.2±40.0 °C(Predicted) |
| density | 1.171±0.06 g/cm3(Predicted) |
| refractive index | 8 ° (C=5, H2O) |
| storage temp. | 2-8°C |
| solubility | Soluble in Water (up to 20 mg/ml). |
| form | powder |
| pka | 2.24±0.10(Predicted) |
| color | White |
| Odor | Odorless |
| Water Solubility | almost transparency |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in distilled water may be stored at -20° for up to 2 months. |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-5(7(11)12)3-4-6(8)10/h5,9H,2-4H2,1H3,(H2,8,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CCC(N)=O)NCC |
| LogP | -0.661 (est) |
| CAS DataBase Reference | 3081-61-6(CAS DataBase Reference) |


| L-Theanine Basic information | |
| Product Name: | L-Theanine |
| CAS: | 3081-61-6 |
| MF: | C7H14N2O3 |
| MW: | 174.2 |
| EINECS: | 221-379-0 |
| Mol File: | 3081-61-6.mol |
| L-Theanine Chemical Properties | |
| Melting point | 207°C |
| Boiling point | 430.2±40.0 °C(Predicted) |
| density | 1.171±0.06 g/cm3(Predicted) |
| refractive index | 8 ° (C=5, H2O) |
| storage temp. | 2-8°C |
| solubility | Soluble in Water (up to 20 mg/ml). |
| form | powder |
| pka | 2.24±0.10(Predicted) |
| color | White |
| Odor | Odorless |
| Water Solubility | almost transparency |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in distilled water may be stored at -20° for up to 2 months. |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-5(7(11)12)3-4-6(8)10/h5,9H,2-4H2,1H3,(H2,8,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| SMILES | C(O)(=O)[C@H](CCC(N)=O)NCC |
| LogP | -0.661 (est) |
| CAS DataBase Reference | 3081-61-6(CAS DataBase Reference) |


