Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
5995-86-8
Futurechemical
5995-86-8
| Gallic acid monohydrate Basic information | |
| Product Name: | Gallic acid monohydrate |
| CAS: | 5995-86-8 |
| MF: | C7H8O6 |
| MW: | 188.13 |
| EINECS: | 611-919-7 |
| Mol File: | 5995-86-8.mol |
| Gallic acid monohydrate Chemical Properties | |
| Melting point | 252 °C (dec.)(lit.) |
| density | 1.694 |
| Fp | 250 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | It is soluble in alcohol, ether, glycerol, acetone negligible in benzene, chloroform, petroleum ether. |
| form | Solid |
| color | White to cream |
| Water Solubility | 15 g/l (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 144,345 |
| BRN | 2050274 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H6O5.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);1H2 |
| InChIKey | IUTKPPDDLYYMBE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(O)=C(O)C(O)=C1.[H]O[H] |
| CAS DataBase Reference | 5995-86-8(CAS DataBase Reference) |


| Gallic acid monohydrate Basic information | |
| Product Name: | Gallic acid monohydrate |
| CAS: | 5995-86-8 |
| MF: | C7H8O6 |
| MW: | 188.13 |
| EINECS: | 611-919-7 |
| Mol File: | 5995-86-8.mol |
| Gallic acid monohydrate Chemical Properties | |
| Melting point | 252 °C (dec.)(lit.) |
| density | 1.694 |
| Fp | 250 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | It is soluble in alcohol, ether, glycerol, acetone negligible in benzene, chloroform, petroleum ether. |
| form | Solid |
| color | White to cream |
| Water Solubility | 15 g/l (20 ºC) |
| Sensitive | Hygroscopic |
| Merck | 144,345 |
| BRN | 2050274 |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C7H6O5.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);1H2 |
| InChIKey | IUTKPPDDLYYMBE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(O)=C(O)C(O)=C1.[H]O[H] |
| CAS DataBase Reference | 5995-86-8(CAS DataBase Reference) |


