Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
1115-47-5
Futurechemical
1115-47-5
| N-Acetyl-DL-methionine Basic information | |
| Product Name: | N-Acetyl-DL-methionine |
| CAS: | 1115-47-5 |
| MF: | C7H13NO3S |
| MW: | 191.25 |
| EINECS: | 214-224-3 |
| Mol File: | 1115-47-5.mol |
| N-Acetyl-DL-methionine Chemical Properties | |
| Melting point | 117-119 °C(lit.) |
| Boiling point | 453.6±40.0 °C(Predicted) |
| density | 1.2684 (rough estimate) |
| refractive index | 1.6370 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.50±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water, ethanol, ethyl acetate. |
| Merck | 14,96 |
| BRN | 1725554 |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CCSC)NC(C)=O |
| CAS DataBase Reference | 1115-47-5(CAS DataBase Reference) |
| EPA Substance Registry System | Methionine, N-acetyl- (1115-47-5) |


| N-Acetyl-DL-methionine Basic information | |
| Product Name: | N-Acetyl-DL-methionine |
| CAS: | 1115-47-5 |
| MF: | C7H13NO3S |
| MW: | 191.25 |
| EINECS: | 214-224-3 |
| Mol File: | 1115-47-5.mol |
| N-Acetyl-DL-methionine Chemical Properties | |
| Melting point | 117-119 °C(lit.) |
| Boiling point | 453.6±40.0 °C(Predicted) |
| density | 1.2684 (rough estimate) |
| refractive index | 1.6370 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.50±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water, ethanol, ethyl acetate. |
| Merck | 14,96 |
| BRN | 1725554 |
| InChI | InChI=1S/C7H13NO3S/c1-5(9)8-6(7(10)11)3-4-12-2/h6H,3-4H2,1-2H3,(H,8,9)(H,10,11)/t6-/m0/s1 |
| InChIKey | XUYPXLNMDZIRQH-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@H](CCSC)NC(C)=O |
| CAS DataBase Reference | 1115-47-5(CAS DataBase Reference) |
| EPA Substance Registry System | Methionine, N-acetyl- (1115-47-5) |


