Tel:
+86 15628782329
+86 15628782329
| Availability: | |
|---|---|
| Quantity: | |
33454-82-9
Futurechemical
33454-82-9
| Lithium trifluoromethanesulfonate Basic information | |
| Product Name: | Lithium trifluoromethanesulfonate |
| CAS: | 33454-82-9 |
| MF: | CF3LiO3S |
| MW: | 156.01 |
| EINECS: | 251-528-5 |
| Mol File: | 33454-82-9.mol |
| Lithium trifluoromethanesulfonate Chemical Properties | |
| Melting point | >300 °C (lit.) |
| density | 1,9 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water |
| form | Powder |
| color | White or colorless |
| Water Solubility | soluble |
| Sensitive | Moisture Sensitive |
| BRN | 4301818 |
| Stability: | hygroscopic |
| InChI | InChI=1S/CHF3O3S.Li/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
| InChIKey | MCVFFRWZNYZUIJ-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S([O-])(=O)=O.[Li+] |
| LogP | 0.3 at 25℃ and pH1 |
| CAS DataBase Reference | 33454-82-9(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, lithium salt (33454-82-9) |


| Lithium trifluoromethanesulfonate Basic information | |
| Product Name: | Lithium trifluoromethanesulfonate |
| CAS: | 33454-82-9 |
| MF: | CF3LiO3S |
| MW: | 156.01 |
| EINECS: | 251-528-5 |
| Mol File: | 33454-82-9.mol |
| Lithium trifluoromethanesulfonate Chemical Properties | |
| Melting point | >300 °C (lit.) |
| density | 1,9 g/cm3 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water |
| form | Powder |
| color | White or colorless |
| Water Solubility | soluble |
| Sensitive | Moisture Sensitive |
| BRN | 4301818 |
| Stability: | hygroscopic |
| InChI | InChI=1S/CHF3O3S.Li/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
| InChIKey | MCVFFRWZNYZUIJ-UHFFFAOYSA-M |
| SMILES | C(F)(F)(F)S([O-])(=O)=O.[Li+] |
| LogP | 0.3 at 25℃ and pH1 |
| CAS DataBase Reference | 33454-82-9(CAS DataBase Reference) |
| EPA Substance Registry System | Methanesulfonic acid, trifluoro-, lithium salt (33454-82-9) |


