| Availability: | |
|---|---|
81-84-5
futurechemical
81-84-5
1,8-Naphthalic anhydride Basic information | |
Product Name: | 1,8-Naphthalic anhydride |
CAS: | 81-84-5 |
MF: | C12H6O3 |
MW: | 198.17 |
EINECS: | 201-380-2 |
Mol File: | 81-84-5.mol |
1,8-Naphthalic anhydride Chemical Properties | |
Melting point | 269 °C |
Boiling point | 295.48°C (rough estimate) |
density | 1.2571 (rough estimate) |
vapor pressure | 0Pa at 25℃ |
refractive index | 1.5550 (estimate) |
Fp | 272 °C |
storage temp. | Store below +30°C. |
solubility | Chloroform (Slightly, Heated), DMSO |
form | Powder |
color | Beige to light brown |
Water Solubility | decomposes |
Sensitive | Moisture Sensitive |
BRN | 153190 |
Henry's Law Constant | 1.6×101 mol/(m3Pa) at 25℃, HSDB (2015) |
InChI | 1S/C12H6O3/c13-11-8-5-1-3-7-4-2-6-9(10(7)8)12(14)15-11/h1-6H |
InChIKey | GRSMWKLPSNHDHA-UHFFFAOYSA-N |
SMILES | O=C1OC(=O)c2cccc3cccc1c23 |
LogP | 3.24 |
Surface tension | 72.5mN/m at 1.3mg/L and 20℃ |
CAS DataBase Reference | 81-84-5(CAS DataBase Reference) |
NIST Chemistry Reference | 1,8-Naphthalic anhydride(81-84-5) |
EPA Substance Registry System | 1,8-Naphthalic anhydride (81-84-5) |