Availability: | |
---|---|
Quantity: | |
155090-83-8
Futurechemical
155090-83-8
Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) Basic information | |
Product Name: | Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) |
CAS: | 155090-83-8 |
MF: | (C8H8O3S)x?x(C6H6O2S)x |
MW: | 0 |
EINECS: | 629-200-1 |
Mol File: | 155090-83-8.mol |
Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) Chemical Properties | |
Melting point | >300 °C |
density | 1.011 g/cm3 (dried coatings) |
refractive index | n20/D 1.344 |
Fp | 100 °C |
storage temp. | 20-25°C |
solubility | 1.3-1.7% Solidssoluble |
form | pellets |
PH | 5月7日 |
InChIKey | BBLBZBXLUSRSNO-UHFFFAOYSA-N |
SMILES | C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.S1C(C2SC(C)=C3OCCOC3=2)=C2OCCOC2=C1C1SC(C)=C2OCCOC=12 |
CAS DataBase Reference | 155090-83-8(CAS DataBase Reference) |
EPA Substance Registry System | Benzenesulfonic acid, ethenyl-, homopolymer, compd. with 2,3-dihydrothieno[3,4-b]-1,4-dioxin homopolymer (155090-83-8) |
Test item | Specification | Result | Unit | Conclusion |
Solid Content | 1.5-2.0 | 1.75 | Wt% | Ok |
Viscosity | ≤100% | 45.2 | Cps | OK |
PH | 2-5 | 3.80 | N/A | OK |
Electric Conductivity | 300-500 | 382.5 | S/cm | OK |
Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) Basic information | |
Product Name: | Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) |
CAS: | 155090-83-8 |
MF: | (C8H8O3S)x?x(C6H6O2S)x |
MW: | 0 |
EINECS: | 629-200-1 |
Mol File: | 155090-83-8.mol |
Poly(3,4-ethylenedioxythiophene)-poly(styrenesulfonate) Chemical Properties | |
Melting point | >300 °C |
density | 1.011 g/cm3 (dried coatings) |
refractive index | n20/D 1.344 |
Fp | 100 °C |
storage temp. | 20-25°C |
solubility | 1.3-1.7% Solidssoluble |
form | pellets |
PH | 5月7日 |
InChIKey | BBLBZBXLUSRSNO-UHFFFAOYSA-N |
SMILES | C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.C1C(C(CC)C)=CC=C(S(=O)(O)=O)C=1.S1C(C2SC(C)=C3OCCOC3=2)=C2OCCOC2=C1C1SC(C)=C2OCCOC=12 |
CAS DataBase Reference | 155090-83-8(CAS DataBase Reference) |
EPA Substance Registry System | Benzenesulfonic acid, ethenyl-, homopolymer, compd. with 2,3-dihydrothieno[3,4-b]-1,4-dioxin homopolymer (155090-83-8) |
Test item | Specification | Result | Unit | Conclusion |
Solid Content | 1.5-2.0 | 1.75 | Wt% | Ok |
Viscosity | ≤100% | 45.2 | Cps | OK |
PH | 2-5 | 3.80 | N/A | OK |
Electric Conductivity | 300-500 | 382.5 | S/cm | OK |